5-METHOXY-1-(5-METHYLFURAN-2-YL)PENTANE-1,3-DIONE

pro_cas
pro_cdbregno
CCD01084357
pro_formula
C11 H14 O4
pro_molWeight
210.228

basic_info

Product_Name: 5-METHOXY-1-(5-METHYLFURAN-2-YL)PENTANE-1,3-DIONE
EnglishSynonyms: 5-METHOXY-1-(5-METHYLFURAN-2-YL)PENTANE-1,3-DIONE
pro_mdlNumber: MFCD11178704
pro_acceptors: 4
pro_donors: 0
pro_smile: Cc1ccc(o1)C(=O)CC(=O)CCOC
InChi: InChI=1S/C11H14O4/c1-8-3-4-11(15-8)10(13)7-9(12)5-6-14-2/h3-4H,5-7H2,1-2H3
InChiKey: InChIKey=OWEOKRQASKQKDI-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.