4,4-DIMETHYL-1-(5-METHYLFURAN-2-YL)PENTANE-1,3-DIONE

pro_cas
pro_cdbregno
CCD01090754
pro_formula
C12 H16 O3
pro_molWeight
208.255

basic_info

Product_Name: 4,4-DIMETHYL-1-(5-METHYLFURAN-2-YL)PENTANE-1,3-DIONE
EnglishSynonyms: 4,4-DIMETHYL-1-(5-METHYLFURAN-2-YL)PENTANE-1,3-DIONE
pro_mdlNumber: MFCD11185132
pro_acceptors: 3
pro_donors: 0
pro_smile: Cc1ccc(o1)C(=O)CC(=O)C(C)(C)C
InChi: InChI=1S/C12H16O3/c1-8-5-6-10(15-8)9(13)7-11(14)12(2,3)4/h5-6H,7H2,1-4H3
InChiKey: InChIKey=AHJCVJZBDKJNFN-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.