3-CYCLOHEXYL-1H-PYRAZOLE

pro_cas
60061-66-7
pro_cdbregno
CCD01129448
pro_formula
C9 H14 N2
pro_molWeight
150.224

basic_info

Product_Name: 3-CYCLOHEXYL-1H-PYRAZOLE
CAS: 60061-66-7
EnglishSynonyms: 3-CYCLOHEXYL PYRAZOLE ; 3-CYCLOHEXYL-1H-PYRAZOLE
pro_mdlNumber: MFCD11499033
pro_acceptors: 2
pro_donors: 1
pro_smile: c1c[nH]nc1C2CCCCC2
InChi: InChI=1S/C9H14N2/c1-2-4-8(5-3-1)9-6-7-10-11-9/h6-8H,1-5H2,(H,10,11)
InChiKey: InChIKey=RISQWZNRZAZRPJ-UHFFFAOYSA-N