TERT-BUTYL 5-(TRIFLUOROMETHYL)-1,4-DIAZEPANE-1-CARBOXYLATE

pro_cas
pro_cdbregno
CCD01165713
pro_formula
C11 H19 F3 N2 O2
pro_molWeight
268.277

basic_info

Product_Name: TERT-BUTYL 5-(TRIFLUOROMETHYL)-1,4-DIAZEPANE-1-CARBOXYLATE
EnglishSynonyms: TERT-BUTYL 5-(TRIFLUOROMETHYL)-1,4-DIAZEPANE-1-CARBOXYLATE
pro_mdlNumber: MFCD11537852
pro_acceptors: 4
pro_donors: 1
pro_smile: CC(C)(C)OC(=O)N1CCC(NCC1)C(F)(F)F
InChi: InChI=1S/C11H19F3N2O2/c1-10(2,3)18-9(17)16-6-4-8(11(12,13)14)15-5-7-16/h8,15H,4-7H2,1-3H3
InChiKey: InChIKey=MXYCFUAPIQPQRJ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.