5-BROMO-3-[(CARBAMOYLMETHANE)SULFONYL]-2-FLUOROBENZOIC ACID

pro_cas
pro_cdbregno
CCD01167510
pro_formula
C9 H7 Br F N O5 S
pro_molWeight
340.124

basic_info

Product_Name: 5-BROMO-3-[(CARBAMOYLMETHANE)SULFONYL]-2-FLUOROBENZOIC ACID
EnglishSynonyms: 5-BROMO-3-[(CARBAMOYLMETHANE)SULFONYL]-2-FLUOROBENZOIC ACID
pro_mdlNumber: MFCD11539649
pro_acceptors: 6
pro_donors: 2
pro_smile: c1c(cc(c(c1C(=O)O)F)S(=O)(=O)CC(=O)N)Br
InChi: InChI=1S/C9H7BrFNO5S/c10-4-1-5(9(14)15)8(11)6(2-4)18(16,17)3-7(12)13/h1-2H,3H2,(H2,12,13)(H,14,15)
InChiKey: InChIKey=UWPGTNOISICKRG-UHFFFAOYSA-N