3-AMINO-4-(1H-PYRAZOL-1-YL)BENZONITRILE

pro_cas
pro_cdbregno
CCD01557262
pro_formula
C10 H8 N4
pro_molWeight
184.201

basic_info

Product_Name: 3-AMINO-4-(1H-PYRAZOL-1-YL)BENZONITRILE
EnglishSynonyms: 3-AMINO-4-(1H-PYRAZOL-1-YL)BENZONITRILE
pro_mdlNumber: MFCD12189618
pro_acceptors: 4
pro_donors: 1
pro_smile: c1cnn(c1)c2ccc(cc2N)C#N
InChi: InChI=1S/C10H8N4/c11-7-8-2-3-10(9(12)6-8)14-5-1-4-13-14/h1-6H,12H2
InChiKey: InChIKey=YPUJFYCTFYBAJI-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.