5-[(2,5-DIFLUOROPHENYL)SULFANYL]-1,3-BENZOTHIAZOL-4-AMINE

pro_cas
pro_cdbregno
CCD01697123
pro_formula
C13 H8 F2 N2 S2
pro_molWeight
294.348

basic_info

Product_Name: 5-[(2,5-DIFLUOROPHENYL)SULFANYL]-1,3-BENZOTHIAZOL-4-AMINE
EnglishSynonyms: 5-[(2,5-DIFLUOROPHENYL)SULFANYL]-1,3-BENZOTHIAZOL-4-AMINE
pro_mdlNumber: MFCD12582895
pro_acceptors: 2
pro_donors: 1
pro_smile: c1cc(c(cc1F)Sc2ccc3c(c2N)ncs3)F
InChi: InChI=1S/C13H8F2N2S2/c14-7-1-2-8(15)11(5-7)19-9-3-4-10-13(12(9)16)17-6-18-10/h1-6H,16H2
InChiKey: InChIKey=RDAHPBPFSYHDFM-UHFFFAOYSA-N