5-[METHYL(PENTAN-2-YL)AMINO]-2-NITROBENZOIC ACID

pro_cas
pro_cdbregno
CCD01698799
pro_formula
C13H18N2O4
pro_molWeight
266.295

basic_info

Product_Name: 5-[METHYL(PENTAN-2-YL)AMINO]-2-NITROBENZOIC ACID
EnglishSynonyms: 5-[METHYL(PENTAN-2-YL)AMINO]-2-NITROBENZOIC ACID
pro_mdlNumber: MFCD12585823
pro_acceptors: 6
pro_donors: 1
pro_smile: CN(C=1C=CC(=C(C(=O)O)C1)[N+](=O)[O-])C(C)CCC
InChi: InChI=1S/C13H18N2O4/c1-4-5-9(2)14(3)10-6-7-12(15(18)19)11(8-10)13(16)17/h6-9H,4-5H2,1-3H3,(H,16,17)
InChiKey: InChIKey=IDTXTYXDNGGBJW-UHFFFAOYSA-N