5-FLUORO-2-[4-(PROPAN-2-YL)PIPERAZIN-1-YL]BENZOIC ACID

pro_cas
pro_cdbregno
CCD01699341
pro_formula
C14 H19 F N2 O2
pro_molWeight
266.314

basic_info

Product_Name: 5-FLUORO-2-[4-(PROPAN-2-YL)PIPERAZIN-1-YL]BENZOIC ACID
EnglishSynonyms: 5-FLUORO-2-[4-(PROPAN-2-YL)PIPERAZIN-1-YL]BENZOIC ACID
pro_mdlNumber: MFCD12586716
pro_acceptors: 4
pro_donors: 1
pro_smile: CC(C)N1CCN(CC1)c2ccc(cc2C(=O)O)F
InChi: InChI=1S/C14H19FN2O2/c1-10(2)16-5-7-17(8-6-16)13-4-3-11(15)9-12(13)14(18)19/h3-4,9-10H,5-8H2,1-2H3,(H,18,19)
InChiKey: InChIKey=PHOMYMAPKBNOGN-UHFFFAOYSA-N