5-BROMO-N-(2-[(ETHYLAMINO)METHYL]PHENYL)THIOPHENE-2-CARBOXAMIDE

pro_cas
pro_cdbregno
CCD01699866
pro_formula
C14 H15 Br N2 O S
pro_molWeight
339.255

basic_info

Product_Name: 5-BROMO-N-(2-[(ETHYLAMINO)METHYL]PHENYL)THIOPHENE-2-CARBOXAMIDE
EnglishSynonyms: 5-BROMO-N-(2-[(ETHYLAMINO)METHYL]PHENYL)THIOPHENE-2-CARBOXAMIDE
pro_mdlNumber: MFCD12587724
pro_acceptors: 3
pro_donors: 2
pro_smile: CCNCc1ccccc1NC(=O)c2ccc(s2)Br
InChi: InChI=1S/C14H15BrN2OS/c1-2-16-9-10-5-3-4-6-11(10)17-14(18)12-7-8-13(15)19-12/h3-8,16H,2,9H2,1H3,(H,17,18)
InChiKey: InChIKey=BCVJDUQUUXFXLV-UHFFFAOYSA-N