1-CYCLOPROPYL-5-[(2,6-DIMETHYLPIPERIDIN-1-YL)CARBONYL]-1H-PYRROL-3-AMINE

pro_cas
pro_cdbregno
CCD01701453
pro_formula
C15 H23 N3 O
pro_molWeight
261.367

basic_info

Product_Name: 1-CYCLOPROPYL-5-[(2,6-DIMETHYLPIPERIDIN-1-YL)CARBONYL]-1H-PYRROL-3-AMINE
EnglishSynonyms: 1-CYCLOPROPYL-5-[(2,6-DIMETHYLPIPERIDIN-1-YL)CARBONYL]-1H-PYRROL-3-AMINE
pro_mdlNumber: MFCD12590582
pro_acceptors: 4
pro_donors: 1
pro_smile: CC1CCCC(N1C(=O)c2cc(cn2C3CC3)N)C
InChi: InChI=1S/C15H23N3O/c1-10-4-3-5-11(2)18(10)15(19)14-8-12(16)9-17(14)13-6-7-13/h8-11,13H,3-7,16H2,1-2H3
InChiKey: InChIKey=CJWLOYLHFYLGJV-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.