2-METHOXY-5-(2,2,2-TRIFLUOROETHANESULFONYL)BENZOIC ACID

pro_cas
pro_cdbregno
CCD01727097
pro_formula
C10 H9 F3 O5 S
pro_molWeight
298.236

basic_info

Product_Name: 2-METHOXY-5-(2,2,2-TRIFLUOROETHANESULFONYL)BENZOIC ACID
EnglishSynonyms: 2-METHOXY-5-(2,2,2-TRIFLUOROETHANESULFONYL)BENZOIC ACID
pro_mdlNumber: MFCD12633176
pro_acceptors: 5
pro_donors: 1
pro_smile: COc1ccc(cc1C(=O)O)S(=O)(=O)CC(F)(F)F
InChi: InChI=1S/C10H9F3O5S/c1-18-8-3-2-6(4-7(8)9(14)15)19(16,17)5-10(11,12)13/h2-4H,5H2,1H3,(H,14,15)
InChiKey: InChIKey=MRFKYGRCIYGEAK-UHFFFAOYSA-N