2,4-DICHLORO-5-(2,2,2-TRIFLUOROETHANESULFONYL)BENZOIC ACID

pro_cas
pro_cdbregno
CCD01727128
pro_formula
C9 H5 Cl2 F3 O4 S
pro_molWeight
337.1

basic_info

Product_Name: 2,4-DICHLORO-5-(2,2,2-TRIFLUOROETHANESULFONYL)BENZOIC ACID
EnglishSynonyms: 2,4-DICHLORO-5-(2,2,2-TRIFLUOROETHANESULFONYL)BENZOIC ACID
pro_mdlNumber: MFCD12633207
pro_acceptors: 4
pro_donors: 1
pro_smile: c1c(c(cc(c1S(=O)(=O)CC(F)(F)F)Cl)Cl)C(=O)O
InChi: InChI=1S/C9H5Cl2F3O4S/c10-5-2-6(11)7(1-4(5)8(15)16)19(17,18)3-9(12,13)14/h1-2H,3H2,(H,15,16)
InChiKey: InChIKey=MEYCUXONYRPNKG-UHFFFAOYSA-N