N-(3-FLUORO-4-METHOXYPHENYL)-8-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE

pro_cas
pro_cdbregno
CCD01750895
pro_formula
C15 H21 F N2 O
pro_molWeight
264.342

basic_info

Product_Name: N-(3-FLUORO-4-METHOXYPHENYL)-8-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE
EnglishSynonyms: N-(3-FLUORO-4-METHOXYPHENYL)-8-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE
pro_mdlNumber: MFCD12667042
pro_acceptors: 3
pro_donors: 1
pro_smile: CN1C2CCC1CC(C2)Nc3ccc(c(c3)F)OC
InChi: InChI=1S/C15H21FN2O/c1-18-12-4-5-13(18)8-11(7-12)17-10-3-6-15(19-2)14(16)9-10/h3,6,9,11-13,17H,4-5,7-8H2,1-2H3
InChiKey: InChIKey=AUMSMEDQZWMNRB-UHFFFAOYSA-N