TRANS-METHYL 4-(4-BROMOPHENYL)PYRROLIDINE-3-CARBOXYLATE

pro_cas
939758-15-3
pro_cdbregno
CCD01804670
pro_formula
C12 H14 Br N O2
pro_molWeight
284.152

basic_info

Product_Name: TRANS-METHYL 4-(4-BROMOPHENYL)PYRROLIDINE-3-CARBOXYLATE
CAS: 939758-15-3
EnglishSynonyms: TRANS-METHYL 4-(4-BROMOPHENYL)PYRROLIDINE-3-CARBOXYLATE
pro_mdlNumber: MFCD12755481
pro_acceptors: 3
pro_donors: 1
pro_smile: COC(=O)[C@H]1CNC[C@@H]1c2ccc(cc2)Br
InChi: InChI=1S/C12H14BrNO2/c1-16-12(15)11-7-14-6-10(11)8-2-4-9(13)5-3-8/h2-5,10-11,14H,6-7H2,1H3/t10-,11+/m1/s1
InChiKey: InChIKey=OHYNFAGOLZTLOM-MNOVXSKESA-N

* If the product has intellectual property rights, a license granted is must or contact us.