(2-[4-METHYL-5-(PROPAN-2-YL)-1H-IMIDAZOL-2-YL]ETHYL)(PROPAN-2-YL)AMINE

pro_cas
pro_cdbregno
CCD01855538
pro_formula
C12H23N3
pro_molWeight
209.335

basic_info

Product_Name: (2-[4-METHYL-5-(PROPAN-2-YL)-1H-IMIDAZOL-2-YL]ETHYL)(PROPAN-2-YL)AMINE
EnglishSynonyms: (2-[4-METHYL-5-(PROPAN-2-YL)-1H-IMIDAZOL-2-YL]ETHYL)(PROPAN-2-YL)AMINE
pro_mdlNumber: MFCD12807264
pro_acceptors: 3
pro_donors: 2
pro_smile: CC=1N=C(NC1C(C)C)CCNC(C)C
InChi: InChI=1S/C12H23N3/c1-8(2)12-10(5)14-11(15-12)6-7-13-9(3)4/h8-9,13H,6-7H2,1-5H3,(H,14,15)
InChiKey: InChIKey=CGHDYLIVAOALNZ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.