BENZENAMINE, N-(3,4-DIMETHYL-2(3H)-THIAZOLYLIDENE)-4-NITRO-

pro_cas
857998-14-2
pro_cdbregno
CCD01991059
pro_formula
C11 H11 N3 O2 S
pro_molWeight
249.293

basic_info

Product_Name: BENZENAMINE, N-(3,4-DIMETHYL-2(3H)-THIAZOLYLIDENE)-4-NITRO-
CAS: 857998-14-2
EnglishSynonyms: N-(3,4-DIMETHYL-2(3H)-THIAZOLYLIDENE)-4-NITRO-BENZENAMINE ; BENZENAMINE, N-(3,4-DIMETHYL-2(3H)-THIAZOLYLIDENE)-4-NITRO-
pro_mdlNumber: MFCD13175552
pro_acceptors: 5
pro_donors: 0
pro_smile: Cc1cs/c(=N/c2ccc(cc2)[N+](=O)[O-])/n1C
InChi: InChI=1S/C11H11N3O2S/c1-8-7-17-11(13(8)2)12-9-3-5-10(6-4-9)14(15)16/h3-7H,1-2H3/b12-11+
InChiKey: InChIKey=DROZKYRBXVMMOX-VAWYXSNFSA-N