BENZENAMINE, N-(3,4-DIMETHYL-2(3H)-THIAZOLYLIDENE)-2,6-DIETHYL-

pro_cas
65709-18-4
pro_cdbregno
CCD01991142
pro_formula
C15 H20 N2 S
pro_molWeight
260.403

basic_info

Product_Name: BENZENAMINE, N-(3,4-DIMETHYL-2(3H)-THIAZOLYLIDENE)-2,6-DIETHYL-
CAS: 65709-18-4
EnglishSynonyms: BENZENAMINE, N-(3,4-DIMETHYL-2(3H)-THIAZOLYLIDENE)-2,6-DIETHYL- ; N-(3,4-DIMETHYL-2(3H)-THIAZOLYLIDENE)-2,6-DIETHYL-BENZENAMINE
pro_mdlNumber: MFCD13175636
pro_acceptors: 2
pro_donors: 0
pro_smile: CCc1cccc(c1/N=c\2/n(c(cs2)C)C)CC
InChi: InChI=1S/C15H20N2S/c1-5-12-8-7-9-13(6-2)14(12)16-15-17(4)11(3)10-18-15/h7-10H,5-6H2,1-4H3/b16-15-
InChiKey: InChIKey=AWDOEWBGNFSGTC-NXVVXOECSA-N