PYRIDO[3,2-E]-1,2,4-TRIAZINE

pro_cas
6133-44-4
pro_cdbregno
CCD01991381
pro_formula
C6 H4 N4
pro_molWeight
132.126

basic_info

Product_Name: PYRIDO[3,2-E]-1,2,4-TRIAZINE
CAS: 6133-44-4
EnglishSynonyms: PYRIDO[3,2-E]-1,2,4-TRIAZINE
pro_mdlNumber: MFCD13175875
pro_acceptors: 4
pro_donors: 0
pro_smile: c1cc2c(nc1)nncn2
InChi: InChI=1S/C6H4N4/c1-2-5-6(7-3-1)10-9-4-8-5/h1-4H
InChiKey: InChIKey=GUODQFHMIYUCLH-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.