6-HYDROXY-6-METHYL-2-PIPERIDINONE

pro_cas
72374-48-2
pro_cdbregno
CCD01994264
pro_formula
C6 H11 N O2
pro_molWeight
129.158

basic_info

Product_Name: 6-HYDROXY-6-METHYL-2-PIPERIDINONE
CAS: 72374-48-2
EnglishSynonyms: 6-HYDROXY-6-METHYL-2-PIPERIDINONE
pro_mdlNumber: MFCD13178799
pro_acceptors: 3
pro_donors: 2
pro_smile: CC1(CCCC(=O)N1)O
InChi: InChI=1S/C6H11NO2/c1-6(9)4-2-3-5(8)7-6/h9H,2-4H2,1H3,(H,7,8)
InChiKey: InChIKey=HHSSLNILVZNZTJ-UHFFFAOYSA-N