PENTYL 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLATE

pro_cas
pro_cdbregno
CCD02098973
pro_formula
C14 H19 N O2
pro_molWeight
233.309

basic_info

Product_Name: PENTYL 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLATE
EnglishSynonyms: PENTYL 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLATE
pro_mdlNumber: MFCD13330525
pro_acceptors: 3
pro_donors: 1
pro_smile: CCCCCOC(=O)c1ccc2c(c1)CCN2
InChi: InChI=1S/C14H19NO2/c1-2-3-4-9-17-14(16)12-5-6-13-11(10-12)7-8-15-13/h5-6,10,15H,2-4,7-9H2,1H3
InChiKey: InChIKey=NVHVRRTVTPKMAN-UHFFFAOYSA-N