TERT-BUTYL((2-[4-METHYL-5-(THIOPHEN-2-YL)-1H-IMIDAZOL-2-YL]ETHYL))AMINE

pro_cas
pro_cdbregno
CCD02125781
pro_formula
C14 H21 N3 S
pro_molWeight
263.407

basic_info

Product_Name: TERT-BUTYL((2-[4-METHYL-5-(THIOPHEN-2-YL)-1H-IMIDAZOL-2-YL]ETHYL))AMINE
EnglishSynonyms: TERT-BUTYL((2-[4-METHYL-5-(THIOPHEN-2-YL)-1H-IMIDAZOL-2-YL]ETHYL))AMINE
pro_mdlNumber: MFCD13434693
pro_acceptors: 3
pro_donors: 2
pro_smile: Cc1c([nH]c(n1)CCNC(C)(C)C)c2cccs2
InChi: InChI=1S/C14H21N3S/c1-10-13(11-6-5-9-18-11)17-12(16-10)7-8-15-14(2,3)4/h5-6,9,15H,7-8H2,1-4H3,(H,16,17)
InChiKey: InChIKey=HYCNNSMKNSWCLW-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.