5-CHLORO-N-(2,2-DIMETHYLPROPYL)-1-METHYL-1H-IMIDAZOLE-4-SULFONAMIDE

pro_cas
pro_cdbregno
CCD02265741
pro_formula
C9 H16 Cl N3 O2 S
pro_molWeight
265.763

basic_info

Product_Name: 5-CHLORO-N-(2,2-DIMETHYLPROPYL)-1-METHYL-1H-IMIDAZOLE-4-SULFONAMIDE
EnglishSynonyms: 5-CHLORO-N-(2,2-DIMETHYLPROPYL)-1-METHYL-1H-IMIDAZOLE-4-SULFONAMIDE
pro_mdlNumber: MFCD14593597
pro_acceptors: 5
pro_donors: 1
pro_smile: CC(C)(C)CNS(=O)(=O)c1c(n(cn1)C)Cl
InChi: InChI=1S/C9H16ClN3O2S/c1-9(2,3)5-12-16(14,15)8-7(10)13(4)6-11-8/h6,12H,5H2,1-4H3
InChiKey: InChIKey=RPWRLLHGUMXBDG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.