4-(3,4-DIMETHOXYPHENYL)-1-ETHYL-1H-IMIDAZOL-5-AMINE

pro_cas
pro_cdbregno
CCD02476544
pro_formula
C13 H17 N3 O2
pro_molWeight
247.296

basic_info

Product_Name: 4-(3,4-DIMETHOXYPHENYL)-1-ETHYL-1H-IMIDAZOL-5-AMINE
EnglishSynonyms: 4-(3,4-DIMETHOXYPHENYL)-1-ETHYL-1H-IMIDAZOL-5-AMINE
pro_mdlNumber: MFCD15513450
pro_acceptors: 5
pro_donors: 1
pro_smile: CCn1cnc(c1N)c2ccc(c(c2)OC)OC
InChi: InChI=1S/C13H17N3O2/c1-4-16-8-15-12(13(16)14)9-5-6-10(17-2)11(7-9)18-3/h5-8H,4,14H2,1-3H3
InChiKey: InChIKey=XNTMOPHUCRQVOW-UHFFFAOYSA-N