4-(8-CHLORO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-1-ETHYL-1H-IMIDAZOL-5-AMINE

pro_cas
pro_cdbregno
CCD02476562
pro_formula
C13 H14 Cl N3 O2
pro_molWeight
279.726

basic_info

Product_Name: 4-(8-CHLORO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-1-ETHYL-1H-IMIDAZOL-5-AMINE
EnglishSynonyms: 4-(8-CHLORO-2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-1-ETHYL-1H-IMIDAZOL-5-AMINE
pro_mdlNumber: MFCD15513468
pro_acceptors: 5
pro_donors: 1
pro_smile: CCn1cnc(c1N)c2cc3c(c(c2)Cl)OCCO3
InChi: InChI=1S/C13H14ClN3O2/c1-2-17-7-16-11(13(17)15)8-5-9(14)12-10(6-8)18-3-4-19-12/h5-7H,2-4,15H2,1H3
InChiKey: InChIKey=UXJWBLPTRCPYOY-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.