3-FLUORO-N-[3-(5-METHYL-1H-PYRAZOL-4-YL)PROPYL]BENZAMIDE

pro_cas
pro_cdbregno
CCD02484649
pro_formula
C14 H16 F N3 O
pro_molWeight
261.298

basic_info

Product_Name: 3-FLUORO-N-[3-(5-METHYL-1H-PYRAZOL-4-YL)PROPYL]BENZAMIDE
EnglishSynonyms: 3-FLUORO-N-[3-(5-METHYL-1H-PYRAZOL-4-YL)PROPYL]BENZAMIDE
pro_mdlNumber: MFCD15521555
pro_acceptors: 4
pro_donors: 2
pro_smile: Cc1c(cn[nH]1)CCCNC(=O)c2cccc(c2)F
InChi: InChI=1S/C14H16FN3O/c1-10-12(9-17-18-10)5-3-7-16-14(19)11-4-2-6-13(15)8-11/h2,4,6,8-9H,3,5,7H2,1H3,(H,16,19)(H,17,18)
InChiKey: InChIKey=PZCPFBHEFYFMRI-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.