4-PYRROLIDIN-1-YL-2-(2-[4-(PYRROLIDIN-1-YLSULFONYL)PHENYL]ETHYL)PYRIMIDINE-5-CARBOXYLIC ACID

pro_cas
pro_cdbregno
CCD02495186
pro_formula
C21 H26 N4 O4 S
pro_molWeight
430.526

basic_info

Product_Name: 4-PYRROLIDIN-1-YL-2-(2-[4-(PYRROLIDIN-1-YLSULFONYL)PHENYL]ETHYL)PYRIMIDINE-5-CARBOXYLIC ACID
EnglishSynonyms: 4-PYRROLIDIN-1-YL-2-(2-[4-(PYRROLIDIN-1-YLSULFONYL)PHENYL]ETHYL)PYRIMIDINE-5-CARBOXYLIC ACID
pro_mdlNumber: MFCD15731464
pro_acceptors: 8
pro_donors: 1
pro_smile: c1cc(ccc1CCc2ncc(c(n2)N3CCCC3)C(=O)O)S(=O)(=O)N4CCCC4
InChi: InChI=1S/C21H26N4O4S/c26-21(27)18-15-22-19(23-20(18)24-11-1-2-12-24)10-7-16-5-8-17(9-6-16)30(28,29)25-13-3-4-14-25/h5-6,8-9,15H,1-4,7,10-14H2,(H,26,27)
InChiKey: InChIKey=RJJNXOBJZZJBCT-UHFFFAOYSA-N