3-[(ETHYLSULFANYL)METHYL]-4-METHOXYBENZALDEHYDE

pro_cas
pro_cdbregno
CCD02625220
pro_formula
C11 H14 O2 S
pro_molWeight
210.296

basic_info

Product_Name: 3-[(ETHYLSULFANYL)METHYL]-4-METHOXYBENZALDEHYDE
EnglishSynonyms: 3-[(ETHYLSULFANYL)METHYL]-4-METHOXYBENZALDEHYDE
pro_mdlNumber: MFCD16163935
pro_acceptors: 2
pro_donors: 0
pro_smile: CCSCc1cc(ccc1OC)C=O
InChi: InChI=1S/C11H14O2S/c1-3-14-8-10-6-9(7-12)4-5-11(10)13-2/h4-7H,3,8H2,1-2H3
InChiKey: InChIKey=MYRHTXSLIKPHAF-UHFFFAOYSA-N