3-AMINO-4-([2-(1H-PYRAZOL-1-YL)ETHYL]AMINO)BENZONITRILE

pro_cas
pro_cdbregno
CCD02637795
pro_formula
C12 H13 N5
pro_molWeight
227.27

basic_info

Product_Name: 3-AMINO-4-([2-(1H-PYRAZOL-1-YL)ETHYL]AMINO)BENZONITRILE
EnglishSynonyms: 3-AMINO-4-([2-(1H-PYRAZOL-1-YL)ETHYL]AMINO)BENZONITRILE
pro_mdlNumber: MFCD16176538
pro_acceptors: 5
pro_donors: 2
pro_smile: c1cnn(c1)CCNc2ccc(cc2N)C#N
InChi: InChI=1S/C12H13N5/c13-9-10-2-3-12(11(14)8-10)15-5-7-17-6-1-4-16-17/h1-4,6,8,15H,5,7,14H2
InChiKey: InChIKey=XQELOJSCKAFMQW-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.