5-PHENYL-1-(1,3-THIAZOL-2-YLMETHYL)-1H-IMIDAZOLE-2-THIOL

pro_cas
pro_cdbregno
CCD02652676
pro_formula
C13 H11 N3 S2
pro_molWeight
273.383

basic_info

Product_Name: 5-PHENYL-1-(1,3-THIAZOL-2-YLMETHYL)-1H-IMIDAZOLE-2-THIOL
EnglishSynonyms: 5-PHENYL-1-(1,3-THIAZOL-2-YLMETHYL)-1H-IMIDAZOLE-2-THIOL
pro_mdlNumber: MFCD16191419
pro_acceptors: 3
pro_donors: 0
pro_smile: c1ccc(cc1)c2cnc(n2Cc3nccs3)S
InChi: InChI=1S/C13H11N3S2/c17-13-15-8-11(10-4-2-1-3-5-10)16(13)9-12-14-6-7-18-12/h1-8H,9H2,(H,15,17)
InChiKey: InChIKey=LVNODKWKOXMDKA-UHFFFAOYSA-N