1,6-DIHYDRO-6-METHYL-7H-PYRAZOLO[3,4-D]PYRIDAZIN-7-ONE

pro_cas
69792-72-9
pro_cdbregno
CCD03026870
pro_formula
C6 H6 N4 O
pro_molWeight
150.14

basic_info

Product_Name: 1,6-DIHYDRO-6-METHYL-7H-PYRAZOLO[3,4-D]PYRIDAZIN-7-ONE
CAS: 69792-72-9
EnglishSynonyms: 1,6-DIHYDRO-6-METHYL-7H-PYRAZOLO[3,4-D]PYRIDAZIN-7-ONE ; 6-METHYL-1H,6H,7H-PYRAZOLO[3,4-D]PYRIDAZIN-7-ONE
pro_mdlNumber: MFCD16619851
pro_acceptors: 5
pro_donors: 1
pro_smile: Cn1c(=O)c2c(cn[nH]2)cn1
InChi: InChI=1S/C6H6N4O/c1-10-6(11)5-4(3-8-10)2-7-9-5/h2-3H,1H3,(H,7,9)
InChiKey: InChIKey=OZBRGXVUBRMPFG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.