4-BENZOYLOXANE

pro_cas
639468-72-7
pro_cdbregno
CCD03027372
pro_formula
C12 H14 O2
pro_molWeight
190.241

basic_info

Product_Name: 4-BENZOYLOXANE
CAS: 639468-72-7
EnglishSynonyms: (TETRAHYDRO-2H-PYRAN-4-YL)(PHENYL)METHANONE ; 4-BENZOYLOXANE
pro_mdlNumber: MFCD16620356
pro_acceptors: 2
pro_donors: 0
pro_smile: c1ccc(cc1)C(=O)C2CCOCC2
InChi: InChI=1S/C12H14O2/c13-12(10-4-2-1-3-5-10)11-6-8-14-9-7-11/h1-5,11H,6-9H2
InChiKey: InChIKey=GLRSKPCBJZOJGG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.