(4-AMINO-3-NITROPHENYL)METHANOL

pro_cas
63189-97-9
pro_cdbregno
CCD03069983
pro_formula
C7 H8 N2 O3
pro_molWeight
168.151

basic_info

Product_Name: (4-AMINO-3-NITROPHENYL)METHANOL
CAS: 63189-97-9
EnglishSynonyms: 4-AMINO-3-NITROBENZYL ALCOHOL ; (4-AMINO-3-NITROPHENYL)METHANOL
pro_mdlNumber: MFCD16689888
pro_acceptors: 5
pro_donors: 2
pro_smile: c1cc(c(cc1CO)[N+](=O)[O-])N
InChi: InChI=1S/C7H8N2O3/c8-6-2-1-5(4-10)3-7(6)9(11)12/h1-3,10H,4,8H2
InChiKey: InChIKey=YOROYHPRNGLSAT-UHFFFAOYSA-N