4-METHYL-5-HEXEN-2-ONE

pro_cas
61675-14-7
pro_cdbregno
CCD03125138
pro_formula
C7 H12 O
pro_molWeight
112.171

basic_info

Product_Name: 4-METHYL-5-HEXEN-2-ONE
CAS: 61675-14-7
EnglishSynonyms: 4-METHYLHEX-5-EN-2-ONE ; 5-HEXEN-2-ONE, 4-METHYL- ; 4-METHYL-5-HEXEN-2-ONE
pro_mdlNumber: MFCD16745044
pro_acceptors: 1
pro_donors: 0
pro_smile: CC(CC(=O)C)C=C
InChi: InChI=1S/C7H12O/c1-4-6(2)5-7(3)8/h4,6H,1,5H2,2-3H3
InChiKey: InChIKey=MXGGBUKCVFGCAG-UHFFFAOYSA-N