UKRORGSYN-BB BBV-34349028

pro_cas
pro_cdbregno
CCD03180180
pro_formula
C11 H20 Br N3 O
pro_molWeight
290.203

basic_info

Product_Name: UKRORGSYN-BB BBV-34349028
EnglishSynonyms: UKRORGSYN-BB BBV-34349028
pro_mdlNumber: MFCD16800086
pro_acceptors: 4
pro_donors: 1
pro_smile: CCOCCCNCC(C)n1cc(cn1)Br
InChi: InChI=1S/C11H20BrN3O/c1-3-16-6-4-5-13-7-10(2)15-9-11(12)8-14-15/h8-10,13H,3-7H2,1-2H3
InChiKey: InChIKey=DNOJTGQIXCFNLY-UHFFFAOYSA-N