N-(4-FLUORO-2-METHYLPHENYL)-2-(METHYLAMINO)PROPANAMIDE

pro_cas
pro_cdbregno
CCD03209039
pro_formula
C11 H15 F N2 O
pro_molWeight
210.251

basic_info

Product_Name: N-(4-FLUORO-2-METHYLPHENYL)-2-(METHYLAMINO)PROPANAMIDE
EnglishSynonyms: N-(4-FLUORO-2-METHYLPHENYL)-2-(METHYLAMINO)PROPANAMIDE
pro_mdlNumber: MFCD16828968
pro_acceptors: 3
pro_donors: 2
pro_smile: Cc1cc(ccc1NC(=O)C(C)NC)F
InChi: InChI=1S/C11H15FN2O/c1-7-6-9(12)4-5-10(7)14-11(15)8(2)13-3/h4-6,8,13H,1-3H3,(H,14,15)
InChiKey: InChIKey=UMLLLRPIJCLFLB-UHFFFAOYSA-N