2-[2-(METHYLAMINO)PROPANAMIDO]BUTANOIC ACID

pro_cas
pro_cdbregno
CCD03209470
pro_formula
C8 H16 N2 O3
pro_molWeight
188.225

basic_info

Product_Name: 2-[2-(METHYLAMINO)PROPANAMIDO]BUTANOIC ACID
EnglishSynonyms: 2-[2-(METHYLAMINO)PROPANAMIDO]BUTANOIC ACID
pro_mdlNumber: MFCD16829399
pro_acceptors: 5
pro_donors: 3
pro_smile: CCC(C(=O)O)NC(=O)C(C)NC
InChi: InChI=1S/C8H16N2O3/c1-4-6(8(12)13)10-7(11)5(2)9-3/h5-6,9H,4H2,1-3H3,(H,10,11)(H,12,13)
InChiKey: InChIKey=FIPUQAAGQAQMAK-UHFFFAOYSA-N