C7 H6 N6 S


pro_mdlNumber: MFCD16843718
pro_acceptors: 6
pro_donors: 1
pro_smile: c1cnc(c(n1)C(=S)N)n2cncn2
InChi: InChI=1S/C7H6N6S/c8-6(14)5-7(11-2-1-10-5)13-4-9-3-12-13/h1-4H,(H2,8,14)