4-([(1-ETHYL-1H-IMIDAZOL-2-YL)METHYL]SULFANYL)PYRIDIN-3-AMINE

pro_cas
pro_cdbregno
CCD03243226
pro_formula
C11 H14 N4 S
pro_molWeight
234.326

basic_info

Product_Name: 4-([(1-ETHYL-1H-IMIDAZOL-2-YL)METHYL]SULFANYL)PYRIDIN-3-AMINE
EnglishSynonyms: 4-([(1-ETHYL-1H-IMIDAZOL-2-YL)METHYL]SULFANYL)PYRIDIN-3-AMINE
pro_mdlNumber: MFCD16863155
pro_acceptors: 4
pro_donors: 1
pro_smile: CCn1ccnc1CSc2ccncc2N
InChi: InChI=1S/C11H14N4S/c1-2-15-6-5-14-11(15)8-16-10-3-4-13-7-9(10)12/h3-7H,2,8,12H2,1H3
InChiKey: InChIKey=FPJCHNZRKNUKGM-UHFFFAOYSA-N