4-BROMO-2-METHYL-N-(PYRIMIDIN-4-YLMETHYL)ANILINE

pro_cas
pro_cdbregno
CCD03245920
pro_formula
C12 H12 Br N3
pro_molWeight
278.152

basic_info

Product_Name: 4-BROMO-2-METHYL-N-(PYRIMIDIN-4-YLMETHYL)ANILINE
EnglishSynonyms: 4-BROMO-2-METHYL-N-(PYRIMIDIN-4-YLMETHYL)ANILINE
pro_mdlNumber: MFCD16865849
pro_acceptors: 3
pro_donors: 1
pro_smile: Cc1cc(ccc1NCc2ccncn2)Br
InChi: InChI=1S/C12H12BrN3/c1-9-6-10(13)2-3-12(9)15-7-11-4-5-14-8-16-11/h2-6,8,15H,7H2,1H3
InChiKey: InChIKey=JHTWYJKJWIKQQE-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.