1-(PHENYLSULPHONYL)-4-CYANO-2-IODO-6-METHYL-7-AZAINDOLE

pro_cas
pro_cdbregno
CCD03255825
pro_formula
C15 H10 I N3 O2 S
pro_molWeight
423.229

basic_info

Product_Name: 1-(PHENYLSULPHONYL)-4-CYANO-2-IODO-6-METHYL-7-AZAINDOLE
EnglishSynonyms: 1-(PHENYLSULPHONYL)-4-CYANO-2-IODO-6-METHYL-7-AZAINDOLE
pro_mdlNumber: MFCD16875791
pro_acceptors: 5
pro_donors: 0
pro_smile: Cc1cc(c2cc(n(c2n1)S(=O)(=O)c3ccccc3)I)C#N
InChi: InChI=1S/C15H10IN3O2S/c1-10-7-11(9-17)13-8-14(16)19(15(13)18-10)22(20,21)12-5-3-2-4-6-12/h2-8H,1H3
InChiKey: InChIKey=HCKZKJWERWNGKJ-UHFFFAOYSA-N