7-CHLORO-3-(2,4-DIMETHYLPHENYL)ISOXAZOLO[4,5-D]PYRIMIDINE

pro_cas
pro_cdbregno
CCD03263142
pro_formula
C13 H10 Cl N3 O
pro_molWeight
259.695

basic_info

Product_Name: 7-CHLORO-3-(2,4-DIMETHYLPHENYL)ISOXAZOLO[4,5-D]PYRIMIDINE
EnglishSynonyms: 7-CHLORO-3-(2,4-DIMETHYLPHENYL)ISOXAZOLO[4,5-D]PYRIMIDINE
pro_mdlNumber: MFCD16991429
pro_acceptors: 4
pro_donors: 0
pro_smile: Cc1ccc(c(c1)C)c2c3c(c(ncn3)Cl)on2
InChi: InChI=1S/C13H10ClN3O/c1-7-3-4-9(8(2)5-7)10-11-12(18-17-10)13(14)16-6-15-11/h3-6H,1-2H3
InChiKey: InChIKey=VRBAUPGUFGCPGS-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.