3-CYCLOPROPOXY-2-ETHYL-N,N-DIMETHYLPYRIDIN-4-AMINE

pro_cas
pro_cdbregno
CCD03274869
pro_formula
C12 H18 N2 O
pro_molWeight
206.287

basic_info

Product_Name: 3-CYCLOPROPOXY-2-ETHYL-N,N-DIMETHYLPYRIDIN-4-AMINE
EnglishSynonyms: 3-CYCLOPROPOXY-2-ETHYL-N,N-DIMETHYLPYRIDIN-4-AMINE
pro_mdlNumber: MFCD17003158
pro_acceptors: 3
pro_donors: 0
pro_smile: CCc1c(c(ccn1)N(C)C)OC2CC2
InChi: InChI=1S/C12H18N2O/c1-4-10-12(15-9-5-6-9)11(14(2)3)7-8-13-10/h7-9H,4-6H2,1-3H3
InChiKey: InChIKey=KMCDISLMHBQJSD-UHFFFAOYSA-N