ACETAMIDE, N-(3-BENZOYL-2-THIENYL)-2-BROMO-

pro_cas
52824-89-2
pro_cdbregno
CCD03287151
pro_formula
C13 H10 Br N O2 S
pro_molWeight
324.197

basic_info

Product_Name: ACETAMIDE, N-(3-BENZOYL-2-THIENYL)-2-BROMO-
CAS: 52824-89-2
EnglishSynonyms: N-(3-BENZOYL-2-THIENYL)-2-BROMO-ACETAMIDE ; ACETAMIDE, N-(3-BENZOYL-2-THIENYL)-2-BROMO-
pro_mdlNumber: MFCD17015712
pro_acceptors: 3
pro_donors: 1
pro_smile: c1ccc(cc1)C(=O)c2ccsc2NC(=O)CBr
InChi: InChI=1S/C13H10BrNO2S/c14-8-11(16)15-13-10(6-7-18-13)12(17)9-4-2-1-3-5-9/h1-7H,8H2,(H,15,16)
InChiKey: InChIKey=RUQAPPAPOKMREG-UHFFFAOYSA-N