WUXIAPPTEC WX125068-001

pro_cas
pro_cdbregno
CCD03287906
pro_formula
C23H28N4O4S
pro_molWeight
456.564

basic_info

Product_Name: WUXIAPPTEC WX125068-001
EnglishSynonyms: WUXIAPPTEC WX125068-005 ; WUXIAPPTEC WX125068-010 ; WUXIAPPTEC WX125068-001
pro_mdlNumber: MFCD17016857
pro_acceptors: 8
pro_donors: 0
pro_smile: CSC1=NC2=C(C=N1)C1CN(CC(C2)N1C(=O)OCC1=CC=CC=C1)C(=O)OC(C)(C)C
InChi: InChI=1S/C23H28N4O4S/c1-23(2,3)31-21(28)26-12-16-10-18-17(11-24-20(25-18)32-4)19(13-26)27(16)22(29)30-14-15-8-6-5-7-9-15/h5-9,11,16,19H,10,12-14H2,1-4H3
InChiKey: InChIKey=LAYGWDDMBXUYCI-UHFFFAOYSA-N