KETONE, 4-ISOXAZOLYL 5-ISOXAZOLYL

pro_cas
844681-18-1
pro_cdbregno
CCD03288912
pro_formula
C7 H4 N2 O3
pro_molWeight
164.12

basic_info

Product_Name: KETONE, 4-ISOXAZOLYL 5-ISOXAZOLYL
CAS: 844681-18-1
EnglishSynonyms: KETONE, 4-ISOXAZOLYL 5-ISOXAZOLYL
pro_mdlNumber: MFCD17017866
pro_acceptors: 5
pro_donors: 0
pro_smile: c1cnoc1C(=O)c2cnoc2
InChi: InChI=1S/C7H4N2O3/c10-7(5-3-9-11-4-5)6-1-2-8-12-6/h1-4H
InChiKey: InChIKey=VUMPDWCPNSWCPJ-UHFFFAOYSA-N