SPIRO[3H-INDOLE-3,3'-PYRROLIDIN]-2(1H)-ONE

pro_cas
6786-41-0
pro_cdbregno
CCD03290394
pro_formula
C11 H12 N2 O
pro_molWeight
188.229

basic_info

Product_Name: SPIRO[3H-INDOLE-3,3'-PYRROLIDIN]-2(1H)-ONE
CAS: 6786-41-0
EnglishSynonyms: SPIRO[3H-INDOLE-3,3'-PYRROLIDIN]-2(1H)-ONE ; SPIRO[INDOLINE-3,3'-PYRROLIDIN]-2-ONE
pro_mdlNumber: MFCD17019392
pro_acceptors: 3
pro_donors: 2
pro_smile: c1ccc2c(c1)C3(CCNC3)C(=O)N2
InChi: InChI=1S/C11H12N2O/c14-10-11(5-6-12-7-11)8-3-1-2-4-9(8)13-10/h1-4,12H,5-7H2,(H,13,14)
InChiKey: InChIKey=FQSHLSLQUHZOMV-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.