METHYL 4-CHLORO-1-(3,5-DIMETHYLPHENYL)-5-METHYL-1H-PYRAZOLE-3-CARBOXYLATE

pro_cas
pro_cdbregno
CCD03308371
pro_formula
C14 H15 Cl N2 O2
pro_molWeight
278.737

basic_info

Product_Name: METHYL 4-CHLORO-1-(3,5-DIMETHYLPHENYL)-5-METHYL-1H-PYRAZOLE-3-CARBOXYLATE
EnglishSynonyms: METHYL 4-CHLORO-1-(3,5-DIMETHYLPHENYL)-5-METHYL-1H-PYRAZOLE-3-CARBOXYLATE
pro_mdlNumber: MFCD17028571
pro_acceptors: 4
pro_donors: 0
pro_smile: Cc1cc(cc(c1)n2c(c(c(n2)C(=O)OC)Cl)C)C
InChi: InChI=1S/C14H15ClN2O2/c1-8-5-9(2)7-11(6-8)17-10(3)12(15)13(16-17)14(18)19-4/h5-7H,1-4H3
InChiKey: InChIKey=GCSFWUMKWSDNTO-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.