N-(4-METHYL-1,3-THIAZOL-2-YL)-6-(METHYLAMINO)PYRIDINE-3-CARBOXAMIDE

pro_cas
pro_cdbregno
CCD03316303
pro_formula
C11 H12 N4 O S
pro_molWeight
248.309

basic_info

Product_Name: N-(4-METHYL-1,3-THIAZOL-2-YL)-6-(METHYLAMINO)PYRIDINE-3-CARBOXAMIDE
EnglishSynonyms: N-(4-METHYL-1,3-THIAZOL-2-YL)-6-(METHYLAMINO)PYRIDINE-3-CARBOXAMIDE
pro_mdlNumber: MFCD17036896
pro_acceptors: 5
pro_donors: 2
pro_smile: Cc1csc(n1)NC(=O)c2ccc(nc2)NC
InChi: InChI=1S/C11H12N4OS/c1-7-6-17-11(14-7)15-10(16)8-3-4-9(12-2)13-5-8/h3-6H,1-2H3,(H,12,13)(H,14,15,16)
InChiKey: InChIKey=KFUZQKXCHQIREQ-UHFFFAOYSA-N