5-CHLORO-2-(METHYLAMINO)-N-[(5-METHYLTHIOPHEN-2-YL)METHYL]BENZAMIDE

pro_cas
pro_cdbregno
CCD03317239
pro_formula
C14 H15 Cl N2 O S
pro_molWeight
294.805

basic_info

Product_Name: 5-CHLORO-2-(METHYLAMINO)-N-[(5-METHYLTHIOPHEN-2-YL)METHYL]BENZAMIDE
EnglishSynonyms: 5-CHLORO-2-(METHYLAMINO)-N-[(5-METHYLTHIOPHEN-2-YL)METHYL]BENZAMIDE
pro_mdlNumber: MFCD17037847
pro_acceptors: 3
pro_donors: 2
pro_smile: Cc1ccc(s1)CNC(=O)c2cc(ccc2NC)Cl
InChi: InChI=1S/C14H15ClN2OS/c1-9-3-5-11(19-9)8-17-14(18)12-7-10(15)4-6-13(12)16-2/h3-7,16H,8H2,1-2H3,(H,17,18)
InChiKey: InChIKey=RZWYWKHOGGCLFU-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.